
CAS 84215-46-3
:(T-4)-Trihydro(4-phenylmorpholine-κN4)boron
Description:
(T-4)-Trihydro(4-phenylmorpholine-κN4)boron, with the CAS number 84215-46-3, is a boron-containing compound characterized by its unique coordination with a 4-phenylmorpholine ligand. This compound typically exhibits properties associated with boron complexes, such as potential applications in organic synthesis and materials science. The presence of the morpholine ring contributes to its solubility and reactivity, while the phenyl group can enhance its stability and influence its electronic properties. The trihydro designation indicates that the boron atom is coordinated with three hydrogen atoms, which may affect its reactivity and interaction with other chemical species. Such compounds are often studied for their role in catalysis, drug delivery, or as intermediates in organic reactions. Additionally, the specific arrangement of atoms and functional groups in (T-4)-Trihydro(4-phenylmorpholine-κN4)boron can lead to interesting chemical behavior, making it a subject of interest in both academic and industrial research.
Formula:C10H16BNO
InChI:InChI=1S/C10H16BNO/c11-12(6-8-13-9-7-12)10-4-2-1-3-5-10/h1-5H,6-9H2,11H3
InChI key:InChIKey=JMFFWIJHTNXOTJ-UHFFFAOYSA-N
SMILES:[B+3]([H-])([H-])([H-])[N]1(CCOCC1)C2=CC=CC=C2
Synonyms:- Boron, trihydro(4-phenylmorpholine-N4)-, (T-4)-
- Boron, trihydro(4-phenylmorpholine-κN4)-, (T-4)-
- Morpholine, 4-phenyl-, boron complex
- (T-4)-Trihydro(4-phenylmorpholine-κN4)boron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
