CAS 84217-11-8
:(5Z,9beta,11alpha,13E,15S)-7-fluoro-11,15-dihydroxy-6,9-epoxyprosta-5,13-dien-1-oic acid
Description:
The chemical substance known as (5Z,9beta,11alpha,13E,15S)-7-fluoro-11,15-dihydroxy-6,9-epoxyprosta-5,13-dien-1-oic acid, with the CAS number 84217-11-8, is a synthetic derivative of prostaglandins, which are lipid compounds that have diverse hormone-like effects in animals. This compound features a complex structure characterized by multiple stereocenters, a fluorine atom, and hydroxyl groups, contributing to its biological activity. The presence of the epoxy group and the specific configuration of double bonds in the prosta structure are crucial for its interaction with biological receptors. It is known to exhibit anti-inflammatory properties and may influence various physiological processes, including pain modulation and vascular function. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. As with many prostaglandin analogs, it may have therapeutic applications, but its use would depend on further pharmacological studies to establish efficacy and safety profiles.
Formula:C20H31FO5
InChI:InChI=1/C20H31FO5/c1-2-3-4-7-13(22)10-11-14-15(23)12-17-19(14)20(21)16(26-17)8-5-6-9-18(24)25/h8,10-11,13-15,17,19-20,22-23H,2-7,9,12H2,1H3,(H,24,25)/b11-10+,16-8-/t13-,14-,15+,17+,19+,20?/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.