CymitQuimica logo

CAS 84222-47-9

:

9-[2-(Benzyloxy)-1-(benzyloxymethyl)ethoxymethyl]-6-chloro-9H-purin-2-amine

Description:
The chemical substance known as 9-[2-(Benzyloxy)-1-(benzyloxymethyl)ethoxymethyl]-6-chloro-9H-purin-2-amine, with the CAS number 84222-47-9, is a purine derivative characterized by its complex structure that includes a chloro group and multiple benzyloxy substituents. This compound typically exhibits properties associated with purines, such as potential biological activity, particularly in the context of nucleic acid metabolism or as a pharmacological agent. The presence of the benzyloxy groups suggests that it may have enhanced lipophilicity, which could influence its solubility and permeability across biological membranes. Additionally, the chloro substituent may impart specific reactivity or stability characteristics. Such compounds are often investigated for their potential therapeutic applications, including antiviral or anticancer properties, due to their structural similarity to naturally occurring nucleobases. Overall, the unique combination of functional groups in this molecule contributes to its potential utility in medicinal chemistry and biochemistry.
Formula:C23H24ClN5O3
InChI:InChI=1/C23H24ClN5O3/c24-21-20-22(28-23(25)27-21)29(15-26-20)16-32-19(13-30-11-17-7-3-1-4-8-17)14-31-12-18-9-5-2-6-10-18/h1-10,15,19H,11-14,16H2,(H2,25,27,28)
SMILES:c1ccc(cc1)COCC(COCc1ccccc1)OCn1cnc2c(Cl)[nH]c(=N)nc12
Synonyms:
  • Biolf-70
  • 9-({[1,3-bis(benzyloxy)propan-2-yl]oxy}methyl)-6-chloro-9H-purin-2-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.