CymitQuimica logo

CAS 84222-50-4

:

2-Amino-1,7-dihydro-7-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6H-purin-6-one

Description:
2-Amino-1,7-dihydro-7-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6H-purin-6-one, with CAS number 84222-50-4, is a purine derivative characterized by its complex molecular structure, which includes an amino group and a hydroxymethyl-substituted ethoxy moiety. This compound typically exhibits properties associated with purines, such as potential biological activity, particularly in relation to nucleic acid metabolism and cellular signaling. It is soluble in polar solvents due to the presence of hydroxyl groups, which enhance its hydrophilicity. The compound may also participate in hydrogen bonding, influencing its interactions with biological macromolecules. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting nucleic acid-related processes. Additionally, the presence of multiple functional groups may contribute to its reactivity and stability under various conditions. Overall, this compound represents a significant interest in biochemical research and drug development due to its structural and functional characteristics.
Formula:C9H13N5O4
InChI:InChI=1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)14(3-11-7)4-18-5(1-15)2-16/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17)
InChI key:InChIKey=NSYYAKAGSCRHJK-UHFFFAOYSA-N
SMILES:C(OC(CO)CO)N1C2=C(N=C1)NC(N)=NC2=O
Synonyms:
  • 6H-Purin-6-one, 2-amino-1,7-dihydro-7-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-
  • 2-Amino-7-(1,3-dihydroxypropan-2-yloxymethyl)-3H-purin-6-one
  • 2-Amino-1,7-dihydro-7-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6H-purin-6-one
  • NSC 377967
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.