CAS 84224-66-8
:3-methyl-1-(trifluoromethyl)dithioxane 1,1-dioxide
Description:
3-Methyl-1-(trifluoromethyl)dithioxane 1,1-dioxide is a chemical compound characterized by its unique structure, which includes a dithioxane ring and a trifluoromethyl group. The presence of the dithioxane moiety indicates that the compound contains two sulfur atoms within a five-membered ring, contributing to its distinctive chemical properties. The trifluoromethyl group enhances the compound's reactivity and polarity, making it useful in various chemical applications, including as a potential intermediate in organic synthesis. The 1,1-dioxide functional group suggests the presence of two double-bonded oxygen atoms, which can influence the compound's stability and reactivity. This compound is likely to exhibit properties typical of sulfur-containing heterocycles, such as increased nucleophilicity and potential for coordination with metal ions. Additionally, the trifluoromethyl group can impart unique electronic characteristics, affecting the compound's behavior in chemical reactions. Overall, 3-methyl-1-(trifluoromethyl)dithioxane 1,1-dioxide is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C2H3F3O3S2
InChI:InChI=1/C2H3F3O3S2/c1-9-8-10(6,7)2(3,4)5/h1H3
SMILES:CSOS(=O)(=O)C(F)(F)F
Synonyms:- Methylsulfenyl trifluoromethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.