CAS 84226-38-0
:3-{4-[3-(trifluoromethyl)phenyl]-3,6-dihydropyridin-1(2H)-yl}propanenitrile
Description:
3-{4-[3-(Trifluoromethyl)phenyl]-3,6-dihydropyridin-1(2H)-yl}propanenitrile, with the CAS number 84226-38-0, is a chemical compound characterized by its complex structure that includes a dihydropyridine moiety and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both the pyridine and nitrile functional groups, such as potential biological activity and solubility in organic solvents. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the nitrile group may contribute to the compound's polar characteristics, affecting its solubility and potential applications in medicinal chemistry. Overall, this compound may be of interest in pharmaceutical research due to its structural features that could lead to various biological activities, although specific biological data would be necessary to fully understand its potential uses.
Formula:C15H15F3N2
InChI:InChI=1/C15H15F3N2/c16-15(17,18)14-4-1-3-13(11-14)12-5-9-20(10-6-12)8-2-7-19/h1,3-5,11H,2,6,8-10H2
SMILES:c1cc(cc(c1)C(F)(F)F)C1=CCN(CCC#N)CC1
Synonyms:- 1(2H)-Pyridinepropanenitrile, 3,6-dihydro-4-(3-(trifluoromethyl)phenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.