CAS 84236-44-2
:4-(2-Methylbutyl)phenyl 4-(octyloxy)benzoate
Description:
4-(2-Methylbutyl)phenyl 4-(octyloxy)benzoate, with the CAS number 84236-44-2, is an organic compound characterized by its ester functional group, which is formed from the reaction of a phenolic compound and a fatty alcohol. This substance typically exhibits properties such as low volatility and moderate solubility in organic solvents, making it suitable for various applications in the chemical and materials industries. It is often used as a plasticizer or additive in polymers, enhancing flexibility and durability. The presence of both aromatic and aliphatic components in its structure contributes to its thermal stability and potential UV resistance. Additionally, the branched alkyl chain (2-methylbutyl) and the octyloxy group can influence its physical properties, such as melting point and viscosity. Safety data sheets should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure safe usage in industrial or laboratory settings.
Formula:C26H36O3
InChI:InChI=1S/C26H36O3/c1-4-6-7-8-9-10-19-28-24-17-13-23(14-18-24)26(27)29-25-15-11-22(12-16-25)20-21(3)5-2/h11-18,21H,4-10,19-20H2,1-3H3
InChI key:InChIKey=XSEXHHROOVDZBQ-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC=C(OCCCCCCCC)C=C1)C2=CC=C(CC(CC)C)C=C2
Synonyms:- Benzoic acid, 4-(octyloxy)-, 4-(2-methylbutyl)phenyl ester, (±)-
- 4-(2-Methylbutyl)phenyl 4-(octyloxy)benzoate
- Benzoic acid, 4-(octyloxy)-, 4-(2-methylbutyl)phenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
