CAS 84243-25-4

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one

Description:

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one, with the CAS number 84243-25-4, is a heterocyclic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen atoms within its framework. This compound features a spiro connection between two five-membered rings, contributing to its rigidity and potential biological activity. The presence of nitrogen atoms in the diaza moiety suggests that it may exhibit interesting properties related to coordination chemistry and biological interactions, such as acting as a ligand in metal complexes. Additionally, the carbonyl group (ketone) in the structure can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's solubility and stability can vary depending on the solvent and environmental conditions, making it relevant in various fields, including medicinal chemistry and materials science. Overall, 1-Oxa-4,9-diazaspiro[5.5]undecan-3-one represents a class of compounds that may have potential applications in drug development and synthetic chemistry due to its unique structural features.

Formula: C₈H₁₄N₂O₂

InChI: InChI=1S/C8H14N2O2/c11-7-5-12-8(6-10-7)1-3-9-4-2-8/h9H,1-6H2,(H,10,11)

InChI key: InChIKey=UZILMRSSGKFWTO-UHFFFAOYSA-N

SMILES: O=C1NCC2(OC1)CCNCC2

Synonyms:

• 1-Oxa-4,9-diazaspiro[5.5]undecan-3-one

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one

CAS: 84243-25-4

Formula: C₈H₁₄N₂O₂

Molecular weight: 170.2090

Ref: IN-DA004XY9

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one

CAS: 84243-25-4

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one is a monoamine inhibitor that has been shown to be an effective treatment for disease conditions such as Parkinson's disease. It inhibits the activity of monoamine oxidase (MAO) and prevents it from breaking down monoamines in the brain. MAO inhibitors have been shown to be effective in treating Parkinson's disease by restoring the balance of neurotransmitters in the brain. 1-Oxa-4,9-diazaspiro[5.5]undecan-3-one is also capable of binding to other receptors involved in modulating neuronal activity, such as serotonin and dopamine receptors.

Formula: C₈H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 170.21 g/mol

Ref: 3D-JDA24325