CAS 84243-98-1

2-deoxy-2-(~18~F)fluoro-3-O-methyl-D-glucose

Description:

2-Deoxy-2-(~18~F)fluoro-3-O-methyl-D-glucose, commonly referred to as [^18F]FDG, is a radiolabeled glucose analog used primarily in positron emission tomography (PET) imaging. This compound is characterized by the substitution of a fluorine-18 isotope at the 2-position of the glucose molecule, which allows for its detection in vivo. The presence of the O-methyl group at the 3-position enhances its stability and bioavailability. As a glucose analog, [^18F]FDG is taken up by cells via glucose transporters and is phosphorylated by hexokinase, although it is not further metabolized, allowing for the accumulation of the radiotracer in metabolically active tissues, such as tumors. This property makes it particularly useful in oncology for tumor detection and monitoring treatment response. The compound is typically synthesized through a series of chemical reactions involving fluorination and methylation, and it is handled with care due to its radioactive nature. Overall, [^18F]FDG plays a crucial role in modern medical imaging and research.

Formula: C₇H₁₃¹⁸FO₅

InChI: InChI=1/C7H13FO5/c1-13-7(4(8)2-9)6(12)5(11)3-10/h2,4-7,10-12H,3H2,1H3/t4-,5+,6+,7+/m0/s1/i8-1