CAS 84245-12-5
:N-[6,9-Dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide
Description:
N-[6,9-Dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide, with CAS number 84245-12-5, is a purine derivative characterized by its complex structure that includes a purine ring system and various functional groups. This compound typically exhibits properties associated with nucleosides, such as potential biological activity, including antiviral or anticancer effects, due to its structural similarity to natural nucleotides. It is soluble in polar solvents, which is common for compounds containing hydroxyl groups. The presence of the acetamide group suggests it may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the hydroxymethyl and ethoxy substituents may enhance its solubility and stability. As with many purine analogs, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of drugs targeting nucleic acid synthesis or cellular processes.
Formula:C11H15N5O5
InChI:InChI=1S/C11H15N5O5/c1-6(19)13-11-14-9-8(10(20)15-11)12-4-16(9)5-21-7(2-17)3-18/h4,7,17-18H,2-3,5H2,1H3,(H2,13,14,15,19,20)
InChI key:InChIKey=WAXOOKOPOHWGBE-UHFFFAOYSA-N
SMILES:C(OC(CO)CO)N1C2=C(C(=O)N=C(NC(C)=O)N2)N=C1
Synonyms:- N-2-Acetylganciclovir(N2-Acetyl-9-(1,3-dihydroxy-2-propoxymethyl)guanine)
- N-[6,9-Dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide
- Acetamide, N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-(9-(((1,3-dihydroxypropan-2-yl)oxy)methyl)-6-oxo-6,9-dihydro-1H-purin-2-yl)acetamide
CAS:Controlled ProductFormula:C11H15N5O5Color and Shape:NeatMolecular weight:297.2673

