CAS 84255-21-0
:2-Ethyl-1H-imidazole-5-carboxylic acid
Description:
2-Ethyl-1H-imidazole-5-carboxylic acid is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group, contributing to its acidic properties. The presence of the ethyl group at the second position of the imidazole ring influences its solubility and reactivity. Typically, compounds like this can exhibit biological activity, making them of interest in pharmaceuticals and biochemistry. The carboxylic acid group can participate in various chemical reactions, such as esterification and amidation, while the imidazole moiety can engage in coordination with metal ions, potentially leading to applications in catalysis or as ligands in coordination chemistry. Additionally, the compound's structure suggests it may have potential as a building block in the synthesis of more complex molecules. Overall, 2-Ethyl-1H-imidazole-5-carboxylic acid is a versatile compound with implications in both synthetic and medicinal chemistry.
Formula:C6H8N2O2
InChI:InChI=1/C6H8N2O2/c1-2-5-7-3-4(8-5)6(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10)
InChI key:InChIKey=NRIUQHNTFFNDMW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1NC(CC)=NC1
Synonyms:- 1H-Imidazole-4-carboxylic acid, 2-ethyl-
- 1H-Imidazole-5-carboxylic acid, 2-ethyl-
- 2-ethyl-1H-imidazole-5-carboxylic acid
- 2-Ethyl-1H-imidazole-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Ethyl-1H-imidazole-4-carboxylic acid
CAS:2-Ethyl-1H-imidazole-4-carboxylic acidPurity:95%Molecular weight:140.142g/mol2-Ethyl-1H-imidazole-4-carboxylic acid
CAS:2-Ethyl-1H-imidazole-4-carboxylic acid is a weak organic acid that is commonly used as an acid catalyst in pharmaceutical formulations. This compound is also used to produce hippuric acid, which is a preservative. The ionization of 2-ethyl-1H-imidazole-4-carboxylic acid depends on its pH. At acidic pH, it has a positive charge and at a neutral pH it has no charge. 2-Ethyl-1H-imidazole-4-carboxylic acid is also an anion at acidic pH and can form complexes with other anions such as citric or phosphoric acids. The functional theory for the formation of these complexes suggest that the carboxyl group coordinates with hydrogen atoms from the other anions, forming covalent bonds.Formula:C6H8N2O2Purity:Min. 95%Molecular weight:140.14 g/mol


