CAS 84255-25-4

2-Ethyl-4-methyl-1H-imidazole-5-carboxylic acid

Description:

2-Ethyl-4-methyl-1H-imidazole-5-carboxylic acid, with the CAS number 84255-25-4, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of ethyl and methyl substituents on the imidazole ring influences its solubility and reactivity, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate polarity due to the carboxylic acid group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the imidazole moiety is known for its biological activity, often serving as a building block in the synthesis of biologically active molecules. Overall, 2-Ethyl-4-methyl-1H-imidazole-5-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and other fields.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1S/C7H10N2O2/c1-3-5-8-4(2)6(9-5)7(10)11/h3H2,1-2H3,(H,8,9)(H,10,11)

InChI key: InChIKey=DKRXGTYXXJTMFZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C)N=C(CC)N1

Synonyms:

• 2-Ethyl-4-methyl-1H-imidazole-5-carboxylic acid
• 2-Ethyl-5-methyl-1H-imidazole-4-carboxylic acid
• 2-Ethyl-5-methyl-1H-imidazole-4-carboxylicacid
• 1H-Imidazole-4-carboxylic acid, 2-ethyl-5-methyl-
• 1H-Imidazole-5-carboxylic acid, 2-ethyl-4-methyl-