CAS 84255-42-5

2-Ethyl-4-methyl-1H-imidazole-5-carbodithioic acid

Description:

2-Ethyl-4-methyl-1H-imidazole-5-carbodithioic acid, with the CAS number 84255-42-5, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carbodithioic acid functional group, which contributes to its reactivity and potential applications in various chemical processes. The presence of ethyl and methyl substituents on the imidazole ring influences its solubility and polarity, making it more versatile in organic synthesis. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in pharmaceuticals or agrochemicals. Additionally, the dithioic acid moiety can participate in coordination chemistry, allowing for interactions with metal ions. Overall, 2-Ethyl-4-methyl-1H-imidazole-5-carbodithioic acid is notable for its unique structural features and potential utility in diverse chemical applications.

Formula: C₇H₁₀N₂S₂

InChI: InChI=1S/C7H10N2S2/c1-3-5-8-4(2)6(9-5)7(10)11/h3H2,1-2H3,(H,8,9)(H,10,11)

InChI key: InChIKey=WQKQGRXNHYXVAH-UHFFFAOYSA-N

SMILES: C(=S)(S)C1=C(C)N=C(CC)N1

Synonyms:

• 2-Ethyl-4-methylimidazole-5-dithiocarboxylic acid
• 1H-Imidazole-4-carbodithioic acid, 2-ethyl-5-methyl-
• 1H-Imidazole-5-carbodithioic acid, 2-ethyl-4-methyl-
• 2-Ethyl-4-methyl-1H-imidazole-5-carbodithioic acid
• 2-Ethyl-5-methylimidazole-4-dithiocarboxylic acid