CAS 84271-78-3

S-{3-[(2,5-dioxopyrrolidin-1-yl)oxy]-3-oxopropyl} ethanethioate

Description:

S-{3-[(2,5-dioxopyrrolidin-1-yl)oxy]-3-oxopropyl} ethanethioate, with the CAS number 84271-78-3, is a chemical compound that features a thioester functional group, which is characterized by the presence of a sulfur atom bonded to a carbonyl group. This compound contains a pyrrolidine ring, indicating it has cyclic amine characteristics, and it also includes an ether linkage due to the presence of the -O- group. The structure suggests that it may exhibit reactivity typical of both thioesters and amides, potentially participating in nucleophilic acyl substitution reactions. The presence of the dioxopyrrolidinyl moiety may impart specific biological activity or pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's solubility and stability can be influenced by its functional groups, which may affect its applications in various chemical and biological contexts. Overall, this compound's unique structure suggests potential utility in synthetic chemistry and drug development.

Formula: C₉H₁₁NO₅S

InChI: InChI=1/C9H11NO5S/c1-6(11)16-5-4-9(14)15-10-7(12)2-3-8(10)13/h2-5H2,1H3

SMILES: CC(=O)SCCC(=O)ON1C(=O)CCC1=O

N-Succinimidyl 3-(Acetylthio)propionate

CAS: 84271-78-3

Formula: C₉H₁₁NO₅S

Purity: >95.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 245.25

Ref: 3B-S0859

SATP

CAS: 84271-78-3

Formula: C₉H₁₁NO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 229.2529

Ref: IN-DA003TCK

N-Succinimidyl-S-Acetylthiopropionate

CAS: 84271-78-3

N-Succinimidyl-S-Acetylthiopropionate

Purity: 99%

Molecular weight: 245.25g/mol

Ref: 54-OR1014481

2,5-DIOXOPYRROLIDIN-1-YL 3-(ACETYLTHIO)PROPANOATE

CAS: 84271-78-3

Formula: C₉H₁₁NO₅S

Purity: 95%

Color and Shape: Solid

Molecular weight: 245.25

Ref: 10-F390287