CAS 84278-00-2
:[(3R,4R,5S,6S)-3,4,6-triacetoxy-5-azido-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance known as [(3R,4R,5S,6S)-3,4,6-triacetoxy-5-azido-tetrahydropyran-2-yl]methyl acetate, with the CAS number 84278-00-2, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including azido (-N3) and acetoxy (-OCOCH3) groups, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The stereochemistry indicated by the R and S designations suggests specific spatial arrangements of the atoms, which can influence the compound's biological activity and interaction with other molecules. The presence of the azido group may allow for further chemical modifications, making it a valuable intermediate in the synthesis of various bioactive compounds. Additionally, the acetoxy groups can enhance solubility and stability, making this compound of interest in pharmaceutical research and development. Overall, its unique structure and functional groups position it as a versatile compound in chemical synthesis and potential therapeutic applications.
Formula:C14H19N3O9
InChI:InChI=1/C14H19N3O9/c1-6(18)22-5-10-12(23-7(2)19)13(24-8(3)20)11(16-17-15)14(26-10)25-9(4)21/h10-14H,5H2,1-4H3/t10?,11-,12-,13+,14+/m0/s1
Synonyms:- 1,3,4,6-Tetra-O-Acetyl-2-Azido-2-Deoxy-D-Galactopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose
CAS:Formula:C14H19N3O9Purity:%Color and Shape:SolidMolecular weight:373.31541,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-galactopyranose
CAS:1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-galactopyranosePurity:>98%Molecular weight:373.32g/mol2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose
CAS:Formula:C14H19N3O9Molecular weight:373.322-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose
CAS:Controlled ProductApplications 2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose (cas# 84278-00-2) is a compound useful in organic synthesis.
References Koeller, K., et al.: Bioorg. Med. Chem., 8, 1017 (2000),Formula:C14H19N3O9Color and Shape:NeatMolecular weight:373.321,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-galactopyranose
CAS:1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-galactopyranose is a carbohydrate that has been shown to bind to the lectin domain of the human insulin receptor. This binding is thought to modulate the activity of this protein. The carbohydrate has also been shown to inhibit the uptake of galactose by pancreatic beta cells in vitro. 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-galactopyranose is postulated to have anti cancer properties and may be used as a blocker for tumor growth.Formula:C14H19N3O9Purity:Min. 95%Color and Shape:White PowderMolecular weight:373.32 g/mol




