
CAS 84282-48-4
:(3E)-2,6-Dimethyl-3-octen-2-ol
Description:
(3E)-2,6-Dimethyl-3-octen-2-ol is an organic compound characterized by its structure, which includes a long carbon chain with multiple functional groups. It features a double bond at the third carbon position, contributing to its classification as an alkene, and a hydroxyl (-OH) group, indicating it is an alcohol. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often associated with floral or fruity notes, making it relevant in the fragrance and flavor industries. Its molecular structure allows for various isomeric forms, but the (3E) configuration specifies the orientation of the double bond, which can influence its reactivity and interactions with other substances. The presence of the two methyl groups at the 2 and 6 positions adds to its hydrophobic character, affecting its solubility in water and its behavior in different chemical environments. As with many organic compounds, it may exhibit volatility and can be flammable, necessitating careful handling in laboratory or industrial settings.
Formula:C10H20O
InChI:InChI=1/C10H20O/c1-5-9(2)7-6-8-10(3,4)11/h6,8-9,11H,5,7H2,1-4H3/b8-6+
InChI key:InChIKey=MPNPHWUUIRXMIS-SOFGYWHQNA-N
SMILES:C(/C=C/C(C)(C)O)C(CC)C
Synonyms:- (3E)-2,6-Dimethyl-3-octen-2-ol
- 3-Octen-2-ol, 2,6-dimethyl-, (E)-
- 3-Octen-2-ol, 2,6-dimethyl-, (3E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.