CAS 84283-08-9
:8-(biphenyl-4-ylamino)-2'-deoxyguanosine
Description:
8-(Biphenyl-4-ylamino)-2'-deoxyguanosine is a modified nucleoside that features a biphenyl-4-ylamino group attached to the 8-position of the guanine base. This compound is characterized by its structural complexity, which includes a deoxyribose sugar moiety and a purine base, specifically guanine. The biphenyl group enhances the compound's hydrophobicity and may influence its interactions with biological macromolecules, such as DNA and proteins. The presence of the amino group can also facilitate hydrogen bonding, potentially affecting the compound's biological activity and stability. This nucleoside derivative is of interest in medicinal chemistry and molecular biology, particularly in studies related to nucleic acid interactions, drug design, and the development of novel therapeutic agents. Its CAS number, 84283-08-9, allows for precise identification in chemical databases and literature. Overall, the unique structural features of 8-(biphenyl-4-ylamino)-2'-deoxyguanosine make it a valuable compound for research in various scientific fields.
Formula:C22H22N6O4
InChI:InChI=1/C22H22N6O4/c23-21-26-19-18(20(31)27-21)25-22(28(19)17-10-15(30)16(11-29)32-17)24-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-17,29-30H,10-11H2,(H,24,25)(H3,23,26,27,31)/t15-,16+,17+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(2’-Deoxyguanosin-8-yl)-4-aminobiphenyl
CAS:Controlled ProductApplications The DNA adduct of 4-Aminobiphenyl.
Formula:C22H22N6O4Color and Shape:NeatMolecular weight:434.45N-(2'-Deoxyguanosin-8-yl)-4-amino(biphenyl)
CAS:N-(2'-Deoxyguanosin-8-yl)-4-amino(biphenyl) (NGB) is a genotoxic compound that causes mutations in mammalian cells. It has been shown to cause cancer in rats, and it is carcinogenic in the bladder of both rats and humans. NGB is also mutagenic to the wild-type strain of bacteria, which may be due to its ability to affect DNA replication. This drug has been detected in human urine at levels as high as 2 micrograms per milliliter and has been found in tissues of mammals, including humans. NGB binds tightly to eicosatetraynoic acid (ETYA), a fatty acid that is an intermediate product of lipid metabolism, which may account for its genotoxic effects.Formula:C22H22N6O4Purity:Min. 95%Molecular weight:434.45 g/mol

