CAS 84283-09-0
:8-(biphenyl-4-ylamino)-2'-deoxyadenosine
Description:
8-(Biphenyl-4-ylamino)-2'-deoxyadenosine is a synthetic nucleoside analog characterized by the presence of a biphenyl-4-ylamino group at the 8-position of the adenine base. This modification can influence its biological activity, potentially enhancing interactions with specific receptors or enzymes. The compound retains the deoxyribose sugar moiety, which is essential for its incorporation into nucleic acids. Its structure suggests potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents, as nucleoside analogs often exhibit significant pharmacological properties. The presence of the biphenyl group may also contribute to increased lipophilicity, affecting its bioavailability and cellular uptake. Additionally, the compound's CAS number, 84283-09-0, allows for easy identification in chemical databases and literature. Overall, 8-(biphenyl-4-ylamino)-2'-deoxyadenosine represents a unique modification of a natural nucleoside, with potential implications in therapeutic applications and research in molecular biology.
Formula:C22H22N6O3
InChI:InChI=1/C22H22N6O3/c23-20-19-21(25-12-24-20)28(18-10-16(30)17(11-29)31-18)22(27-19)26-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9,12,16-18,29-30H,10-11H2,(H,26,27)(H2,23,24,25)/t16-,17+,18+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-([1,1'-Biphenyl]-4-ylamino)-2'-deoxyadenosine
CAS:Controlled ProductFormula:C22H22N6O3Color and Shape:NeatMolecular weight:418.46
