CAS 84284-70-8

4-Benzyloxyphenyl acetylene

Description:

4-Benzyloxyphenyl acetylene, with the CAS number 84284-70-8, is an organic compound characterized by its unique structural features. It consists of a phenyl ring substituted with a benzyloxy group and an acetylene functional group. This compound typically exhibits a white to light yellow crystalline appearance. Its molecular structure contributes to its potential applications in organic synthesis and materials science, particularly in the development of liquid crystals and polymers. The presence of the acetylene moiety allows for various chemical reactions, including cross-coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, the benzyloxy group enhances the compound's solubility in organic solvents, facilitating its use in various chemical processes. The compound's reactivity and stability can be influenced by factors such as temperature and the presence of catalysts. Overall, 4-Benzyloxyphenyl acetylene is a versatile compound with significant implications in both academic research and industrial applications.

Formula: C₁₅H₁₂O

InChI: InChI=1/C15H12O/c1-2-13-8-10-15(11-9-13)16-12-14-6-4-3-5-7-14/h1,3-11H,12H2

SMILES: C#Cc1ccc(cc1)OCc1ccccc1

Synonyms:

• 1-(Benzyloxy)-4-ethynylbenzene
• Benzene, 1-ethynyl-4-(phenylmethoxy)-
• Benzyl 4-ethynylphenyl ether
• 4'-Benzyloxyphenyl acetylene
• 1-Ethynyl-4-(phenylmethoxy)benzene

4'-Benzyloxyphenyl acetylene

CAS: 84284-70-8

Formula: C₁₅H₁₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.2552

Ref: IN-DA00G2XC

[4-(Benzyloxy)phenyl]acetylene

CAS: 84284-70-8

[4-(Benzyloxy)phenyl]acetylene

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.26g/mol

Ref: 54-OR31043

4′-Benzyloxyphenyl acetylene

CAS: 84284-70-8

Formula: C₁₅H₁₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.26

Ref: 10-F040581