CAS 842949-51-3

(1S,5R)-2-Azabicyclo[3.1.0]hexane

Description:

(1S,5R)-2-Azabicyclo[3.1.0]hexane is a bicyclic organic compound characterized by its unique structure, which features a nitrogen atom incorporated into a six-membered ring system. This compound exhibits chirality, with specific stereochemistry at the 1 and 5 positions, contributing to its potential biological activity. The presence of the nitrogen atom in the bicyclic framework often influences its reactivity and interaction with biological targets, making it of interest in medicinal chemistry and drug design. The compound may exhibit properties such as basicity due to the nitrogen atom, which can participate in hydrogen bonding and coordination with other molecules. Its structural features may also allow for conformational flexibility, impacting its pharmacokinetic and pharmacodynamic profiles. As a result, (1S,5R)-2-Azabicyclo[3.1.0]hexane may serve as a valuable scaffold in the development of novel therapeutic agents, particularly in the fields of neuroscience and pain management, where modulation of neurotransmitter systems is crucial.

Formula: C₅H₉N

InChI: InChI=1S/C5H9N/c1-2-6-5-3-4(1)5/h4-6H,1-3H2/t4-,5+/m1/s1

InChI key: InChIKey=WSSDGZWSPMAECX-UHNVWZDZSA-N

SMILES: [C@@]12([C@](C1)(NCC2)[H])[H]

Synonyms:

• 2-Azabicyclo[3.1.0]hexane, (1S,5R)-
• (1S,5R)-2-Azabicyclo[3.1.0]hexane