CAS 842955-24-2
:1-(4-ethoxyphenyl)-N-methylethanamine
Description:
1-(4-Ethoxyphenyl)-N-methylethanamine, identified by its CAS number 842955-24-2, is an organic compound characterized by its amine functional group and an ethoxy-substituted phenyl ring. This compound features a methylethanamine backbone, which contributes to its basicity and potential reactivity. The presence of the ethoxy group enhances its lipophilicity, potentially influencing its solubility in organic solvents and biological membranes. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest it could participate in hydrogen bonding due to the amine group, affecting its interactions with other molecules. Additionally, the compound's molecular structure may allow for diverse synthetic pathways, enabling modifications that could enhance its efficacy or selectivity in biological applications. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure routes.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-4-13-11-7-5-10(6-8-11)9(2)12-3/h5-9,12H,4H2,1-3H3
SMILES:CCOc1ccc(cc1)C(C)NC
Synonyms:- N-[1-(4-ethoxyphenyl)ethyl]-N-methylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.