CymitQuimica logo

CAS 842957-75-9

:

3-[2-(1H-Naphth[2,3-d]imidazol-2-yl)ethyl]benzenamine

Description:
3-[2-(1H-Naphth[2,3-d]imidazol-2-yl)ethyl]benzenamine, with the CAS number 842957-75-9, is a chemical compound characterized by its complex structure that includes a naphthimidazole moiety and an ethyl linker attached to a benzenamine group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential fluorescence and varied solubility depending on the solvent used. The presence of the naphthimidazole structure suggests potential biological activity, as many compounds containing imidazole rings are known for their roles in pharmaceuticals and biochemistry. Additionally, the amine functional group may contribute to its reactivity and ability to form hydrogen bonds, influencing its interactions in biological systems. The compound's unique structure may also impart specific electronic properties, making it of interest in materials science and medicinal chemistry. Overall, its characteristics make it a subject of interest for further research in various chemical and biological applications.
Formula:C19H17N3
InChI:InChI=1S/C19H17N3/c20-16-7-3-4-13(10-16)8-9-19-21-17-11-14-5-1-2-6-15(14)12-18(17)22-19/h1-7,10-12H,8-9,20H2,(H,21,22)
InChI key:InChIKey=JISYKVUSPLFSRH-UHFFFAOYSA-N
SMILES:C(CC1=CC(N)=CC=C1)C=2NC=3C(=CC=4C(C3)=CC=CC4)N2
Synonyms:
  • 3-[2-(1H-Naphth[2,3-d]imidazol-2-yl)ethyl]benzenamine
  • Benzenamine, 3-[2-(1H-naphth[2,3-d]imidazol-2-yl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.