CAS 842961-35-7
:3-amino-4-(4-methylpiperazin-1-yl)benzamide
Description:
3-Amino-4-(4-methylpiperazin-1-yl)benzamide is an organic compound characterized by its aromatic amide structure, which features an amino group and a piperazine moiety. The presence of the benzamide functional group indicates that it has both hydrophilic and lipophilic properties, making it potentially useful in pharmaceutical applications. The piperazine ring contributes to its basicity and can enhance solubility in biological systems. This compound is typically a white to off-white solid, and its molecular structure allows for various interactions, such as hydrogen bonding, which can influence its biological activity. It may exhibit properties such as moderate to high stability under standard conditions, and its reactivity can be influenced by the functional groups present. As a compound of interest in medicinal chemistry, it may be investigated for its potential therapeutic effects, particularly in the context of neuropharmacology or as a scaffold for drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H18N4O
InChI:InChI=1/C12H18N4O/c1-15-4-6-16(7-5-15)11-3-2-9(12(14)17)8-10(11)13/h2-3,8H,4-7,13H2,1H3,(H2,14,17)
SMILES:CN1CCN(CC1)c1ccc(cc1N)C(=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.