CAS 842971-09-9
:3-azepan-1-yl-2,2-dimethylpropanal
Description:
3-Azepan-1-yl-2,2-dimethylpropanal is an organic compound characterized by its unique structure, which includes a seven-membered azepane ring and an aldehyde functional group. The presence of the azepane ring contributes to its cyclic nature, while the aldehyde group at the end of the carbon chain makes it reactive, particularly in condensation and oxidation reactions. The two methyl groups attached to the carbon adjacent to the aldehyde enhance the steric bulk of the molecule, potentially influencing its reactivity and interactions with other substances. This compound may exhibit properties typical of both cyclic amines and aldehydes, such as solubility in polar solvents and the ability to participate in nucleophilic addition reactions. Its specific applications can vary, but it may be of interest in medicinal chemistry or as an intermediate in organic synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential reactivity and toxicity.
Formula:C11H21NO
InChI:InChI=1/C11H21NO/c1-11(2,10-13)9-12-7-5-3-4-6-8-12/h10H,3-9H2,1-2H3
SMILES:CC(C)(CN1CCCCCC1)C=O
Synonyms:- 1H-azepine-1-propanal, hexahydro-alpha,alpha-dimethyl-
- 3-(azepan-1-yl)-2,2-dimethylpropanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.