CAS 842971-69-1

1,2,6-trimethyl-1H-indole-3-carbaldehyde

Description:

1,2,6-Trimethyl-1H-indole-3-carbaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features three methyl groups attached to the indole framework, enhancing its hydrophobic properties and influencing its reactivity. The presence of a formyl group (-CHO) at the 3-position of the indole ring introduces aldehyde characteristics, making it a potential candidate for various chemical reactions, such as condensation and oxidation. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its unique structure can also impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's solubility and stability can vary based on environmental conditions, such as temperature and pH, which are important considerations in its application and handling.

Formula: C₁₂H₁₃NO

InChI: InChI=1/C12H13NO/c1-8-4-5-10-11(7-14)9(2)13(3)12(10)6-8/h4-7H,1-3H3

SMILES: Cc1ccc2c(C=O)c(C)n(C)c2c1

1,2,6-Trimethyl-1H-indole-3-carbaldehyde

CAS: 842971-69-1

1,2,6-Trimethyl-1H-indole-3-carbaldehyde

Purity: 95%

Molecular weight: 187.24g/mol

Ref: 54-OR916793