CAS 842971-74-8
:3-formyl-5-methyl-1H-indole-2-carboxylic acid
Description:
3-Formyl-5-methyl-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a formyl group (-CHO) at the 3-position and a carboxylic acid group (-COOH) at the 2-position, along with a methyl group (-CH3) at the 5-position of the indole ring. These functional groups contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of both the aldehyde and carboxylic acid groups suggests that it can participate in various chemical reactions, such as condensation and esterification. Additionally, the indole moiety is known for its biological significance, often found in various natural products and pharmaceuticals. The compound's solubility, stability, and reactivity can be influenced by the presence of these functional groups, making it a subject of interest for further research in chemical and biological applications.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-6-2-3-9-7(4-6)8(5-13)10(12-9)11(14)15/h2-5,12H,1H3,(H,14,15)
SMILES:Cc1ccc2c(c1)c(C=O)c(C(=O)O)[nH]2
Synonyms:- 1H-indole-2-carboxylic acid, 3-formyl-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
