CAS 842972-47-8
:([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)acetic acid
Description:
([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)acetic acid is a chemical compound characterized by its unique triazole and pyridazine ring structures, which contribute to its potential biological activity. The presence of the triazole moiety often imparts properties such as increased stability and the ability to form hydrogen bonds, which can enhance interactions with biological targets. The acetic acid functional group provides acidity and can influence solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its CAS number, 842972-47-8, allows for precise identification in chemical databases. The compound's synthesis and characterization typically involve standard organic chemistry techniques, and its behavior in various solvents can be studied to understand its solubility and potential applications. Overall, the unique structural features of ([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)acetic acid suggest it may have significant implications in drug discovery and development.
Formula:C7H6N4O3
InChI:InChI=1/C7H6N4O3/c12-7(13)3-14-6-2-1-5-9-8-4-11(5)10-6/h1-2,4H,3H2,(H,12,13)
SMILES:c1cc(nn2cnnc12)OCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.