CymitQuimica logo

CAS 842973-99-3

:

2-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyridine-3-carbaldehyde

Description:
2-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyridine-3-carbaldehyde is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with a benzodioxole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential fluorescence and varied solubility in organic solvents. The presence of the aldehyde functional group suggests reactivity in condensation reactions and potential applications in organic synthesis. Additionally, the benzodioxole unit may contribute to biological activity, as compounds containing this moiety are often investigated for pharmacological properties. The compound's molecular structure allows for various interactions, making it a candidate for studies in medicinal chemistry and material science. Its unique characteristics may also lend themselves to applications in the development of sensors or as intermediates in the synthesis of more complex molecules. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic applications.
Formula:C15H10N2O3
InChI:InChI=1/C15H10N2O3/c18-8-11-15(16-14-3-1-2-6-17(11)14)10-4-5-12-13(7-10)20-9-19-12/h1-8H,9H2
Synonyms:
  • imidazo[1,2-a]pyridine-3-carboxaldehyde, 2-(1,3-benzodioxol-5-yl)-
  • 2-(1,3-Benzodioxol-5-yl)imidazo[1,2-a]pyridine-3-carbaldehyde
  • 2-(1,3-Benzodioxol-5-yl)imidazo[1,2-a]pyridin-3-carbaldehyd
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.