CAS 84298-23-7
:4,4-bis(chloromethyl)-1,3-oxazolidin-2-one
Description:
4,4-Bis(chloromethyl)-1,3-oxazolidin-2-one is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically appears as a solid at room temperature and is known for its reactivity due to the presence of chloromethyl groups, which can participate in nucleophilic substitution reactions. The oxazolidinone moiety contributes to its potential applications in medicinal chemistry, particularly in the synthesis of biologically active compounds. It may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical research. Additionally, the compound's chloromethyl groups can serve as useful intermediates in further chemical transformations. Safety precautions are essential when handling this substance, as it may pose health risks due to its reactive nature and potential toxicity. Proper storage conditions and protective equipment are recommended to mitigate exposure risks. Overall, 4,4-bis(chloromethyl)-1,3-oxazolidin-2-one is a versatile compound with significant implications in organic synthesis and medicinal applications.
Formula:C5H7Cl2NO2
InChI:InChI=1/C5H7Cl2NO2/c6-1-5(2-7)3-10-4(9)8-5/h1-3H2,(H,8,9)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.