CAS 84303-46-8
:3,3',4,4',5-pentabromobiphenyl
Description:
3,3',4,4',5-pentabromobiphenyl is a polybrominated biphenyl (PBB) compound, characterized by the presence of five bromine atoms attached to a biphenyl structure. This compound is typically used as a flame retardant in various materials, including plastics and textiles, due to its ability to inhibit combustion. Its molecular structure consists of two phenyl rings connected by a single bond, with bromine substituents located at the 3, 3', 4, 4', and 5 positions on the rings. The presence of multiple bromine atoms significantly enhances its hydrophobicity and stability, making it resistant to degradation. However, PBBs, including 3,3',4,4',5-pentabromobiphenyl, are of environmental concern due to their persistence, potential bioaccumulation, and toxicity to aquatic and terrestrial organisms. Regulatory measures have been implemented in various regions to limit the use of such compounds, reflecting growing awareness of their environmental and health impacts. As a result, ongoing research focuses on understanding their behavior in ecosystems and developing safer alternatives for flame retardancy.
Formula:C12H5Br5
InChI:InChI=1/C12H5Br5/c13-8-2-1-6(3-9(8)14)7-4-10(15)12(17)11(16)5-7/h1-5H
Synonyms:- 1,1'-Biphenyl, 3,3',4,4',5-pentabromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
