CAS 84310-99-6

2-Ethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid

Description:

2-Ethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid, with the CAS number 84310-99-6, is an organic compound characterized by its unique structure that includes both an amino group and a carboxylic acid functional group. This compound features a butanoic acid backbone, which is substituted with an ethyl group and a trifluoroacetylamino moiety. The presence of the trifluoroacetyl group imparts significant polarity and potential reactivity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity. Additionally, the carboxylic acid group contributes to its acidity and solubility in polar solvents. Overall, this compound's unique functional groups and structural features make it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₈H₁₂F₃NO₃

InChI: InChI=1S/C8H12F3NO3/c1-3-7(4-2,6(14)15)12-5(13)8(9,10)11/h3-4H2,1-2H3,(H,12,13)(H,14,15)

InChI key: InChIKey=ACLAGRMMFRNIQY-UHFFFAOYSA-N

SMILES: C(NC(C(F)(F)F)=O)(C(O)=O)(CC)CC

Synonyms:

• Butanoic acid, 2-ethyl-2-[(trifluoroacetyl)amino]-
• 2,2-Diethyl-N-(trifluoroacetyL)glycine
• 2-Ethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid
• Butanoic acid, 2-ethyl-2-[(2,2,2-trifluoroacetyl)amino]-
• 2-Ethyl-2-(trifluoroacetamido)butanoic acid