CAS 84322-56-5

1,3,5-Trifluoro-2,4,6-triiodobenzene

Description:

1,3,5-Trifluoro-2,4,6-triiodobenzene is an aromatic compound characterized by the presence of three fluorine atoms and three iodine atoms attached to a benzene ring. This compound exhibits a unique combination of halogen substituents, which significantly influence its chemical properties, including its reactivity and stability. The presence of electronegative fluorine atoms contributes to the compound's overall polarity and can enhance its reactivity in nucleophilic substitution reactions. Conversely, the iodine atoms, being larger and less electronegative, can impart different steric and electronic effects. This compound is typically used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Its physical properties, such as melting point and solubility, are influenced by the halogen substituents, which can affect intermolecular interactions. Additionally, due to the presence of multiple halogens, 1,3,5-Trifluoro-2,4,6-triiodobenzene may exhibit unique optical and electronic properties, making it of interest in materials science and medicinal chemistry.

Formula: C₆F₃I₃

InChI: InChI=1/C6F3I3/c7-1-4(10)2(8)6(12)3(9)5(1)11

SMILES: c1(c(c(c(c(c1I)F)I)F)I)F

Synonyms:

• Benzene, 1,3,5-Trifluoro-2,4,6-Triiodo-

1,3,5-Trifluoro-2,4,6-triiodobenzene, 97%

CAS: 84322-56-5

1,3,5-Trifluoro-2,4,6-triiodobenzene is useful for biological applications. Further, it is used as an intermediate in organic synthesis. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the

Formula: C₆F₃I₃

Purity: 97%

Color and Shape: Crystals or powder or crystalline powder, White to pale cream to cream to brown to gray

Molecular weight: 509.78

Ref: 02-H33116

1,3,5-Trifluoro-2,4,6-triiodobenzene

CAS: 84322-56-5

Formula: C₆F₃I₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 509.7728

Ref: IN-DA0032L5

1,3,5-Trifluoro-2,4,6-triiodobenzene

CAS: 84322-56-5

1,3,5-Trifluoro-2,4,6-triiodobenzene

Formula: C₆F₃I₃

Purity: 98%

Color and Shape: solid

Molecular weight: 509.77g/mol

Ref: 54-PC1493

1,3,5-Trifluoro-2,4,6-triiodobenzene

CAS: 84322-56-5

Formula: C₆F₃I₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 509.775

Ref: 10-F044647