CAS 84331-15-7
:2-Bromo-1-(6-fluoro-3-pyridinyl)ethanone
Description:
2-Bromo-1-(6-fluoro-3-pyridinyl)ethanone, with the CAS number 84331-15-7, is a chemical compound characterized by its unique structure, which includes a bromine atom and a fluorinated pyridine moiety. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The fluorine atom in the pyridine ring can influence the compound's electronic properties, potentially enhancing its biological activity or reactivity. 2-Bromo-1-(6-fluoro-3-pyridinyl)ethanone may be utilized in various applications, including medicinal chemistry, where it could serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its properties, such as solubility and stability, can vary based on the solvent and environmental conditions. As with many halogenated compounds, it is important to handle this substance with care, considering its potential toxicity and environmental impact.
Formula:C7H5BrFNO
InChI:InChI=1S/C7H5BrFNO/c8-3-6(11)5-1-2-7(9)10-4-5/h1-2,4H,3H2
InChI key:InChIKey=LJKBMOJQJMPXQW-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C=1C=CC(F)=NC1
Synonyms:- 2-Bromo-1-(6-fluoro-3-pyridinyl)ethanone
- 2-Bromo-1-(6-fluoropyridin-3-yl)ethan-1-one
- Ethanone, 2-bromo-1-(6-fluoro-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.