CAS 84332-82-1

(5-fluoro-2-hydroxyphenyl)mercury - trifluoroacetic acid (1:1)

Description:

(5-Fluoro-2-hydroxyphenyl)mercury - trifluoroacetic acid (1:1), with the CAS number 84332-82-1, is a chemical compound that combines a mercury moiety with a substituted phenolic structure and trifluoroacetic acid. This compound typically exhibits characteristics associated with organomercury compounds, including potential toxicity and bioactivity. The presence of the fluorine and hydroxyl groups on the phenyl ring can influence its reactivity and solubility, potentially enhancing its interaction with biological systems. Trifluoroacetic acid, a strong acid, contributes to the compound's acidity and may affect its stability and reactivity in various environments. Organomercury compounds are known for their applications in organic synthesis and as reagents in various chemical reactions, although they also pose significant environmental and health risks due to mercury's toxicity. Proper handling and disposal are crucial when working with such substances to mitigate potential hazards. Overall, this compound's unique structure and properties make it of interest in both synthetic chemistry and toxicology.

Formula: C₈H₅F₄HgO₃

InChI: InChI=1/C6H4FO.C2HF3O2.Hg/c7-5-1-3-6(8)4-2-5;3-2(4,5)1(6)7;/h1-3,8H;(H,6,7);/rC6H4FHgO.C2HF3O2/c7-4-1-2-6(9)5(8)3-4;3-2(4,5)1(6)7/h1-3,9H;(H,6,7)

SMILES: c1cc(c(cc1F)[Hg])O.C(=O)(C(F)(F)F)O

2-((Trifluoroacetoxy)Mercuri)-4-Fluorophenol

Controlled Product

CAS: 84332-82-1

Please enquire for more information about 2-((Trifluoroacetoxy)Mercuri)-4-Fluorophenol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₈H₄F₄HgO₃

Purity: Min. 95%

Molecular weight: 424.7 g/mol

Ref: 3D-FT88400