CAS 84332-92-3

β-D-Glucopyranose, 6-(dihydrogen phosphate), sodium salt (1:1)

Description:

β-D-Glucopyranose, 6-(dihydrogen phosphate), sodium salt (1:1) is a phosphorylated derivative of glucose, specifically a sugar phosphate that plays a significant role in various biochemical processes. This compound features a glucopyranose ring structure, which is a six-membered cyclic form of glucose, with a phosphate group attached at the 6-position. The sodium salt form indicates that the phosphate group is ionically bonded to sodium ions, enhancing its solubility in aqueous solutions. This substance is typically used in biochemical research and applications, particularly in studies involving metabolic pathways and energy transfer, as it can participate in phosphorylation reactions. Its properties include being hygroscopic and soluble in water, which makes it suitable for laboratory use. Additionally, it may serve as a substrate or intermediate in enzymatic reactions, contributing to the understanding of carbohydrate metabolism. Safety data should be consulted for handling, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₆H₁₃O₉P·Na

InChI: InChI=1S/C6H13O9P.Na/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8;/h2-10H,1H2,(H2,11,12,13);/t2-,3-,4+,5-,6-;/m1./s1

InChI key: InChIKey=ZGBCTYSIFSDDKP-WYRLRVFGSA-N

SMILES: C(OP(=O)(O)O)[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)O1.[Na]

Synonyms:

• β-D-Glucopyranose, 6-(dihydrogen phosphate), monosodium salt
• β-D-Glucopyranose, 6-(dihydrogen phosphate), sodium salt (1:1)