CAS 84333-60-8
:2-amino-2-phenylbutyl 3,4,5-trimethoxybenzoate
Description:
2-amino-2-phenylbutyl 3,4,5-trimethoxybenzoate, with the CAS number 84333-60-8, is a chemical compound characterized by its complex structure, which includes an amino group, a phenyl group, and a benzoate moiety with three methoxy substituents. This compound typically exhibits properties associated with both amines and esters, such as potential solubility in organic solvents and moderate polarity. The presence of the trimethoxybenzoate group suggests that it may have interesting electronic properties and could participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the amino group may impart basicity and the potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values.
Formula:C20H25NO5
InChI:InChI=1/C20H25NO5/c1-5-20(21,15-9-7-6-8-10-15)13-26-19(22)14-11-16(23-2)18(25-4)17(12-14)24-3/h6-12H,5,13,21H2,1-4H3
SMILES:CCC(COC(=O)c1cc(c(c(c1)OC)OC)OC)(c1ccccc1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N-Didesmethyl Trimebutine Hydrochloride
CAS:Applications A metabolite of Trimebutine (T795605).
References Miura, Y., et al.: Drug Metab. Dispos., 17, 455 (1989), Xue, L., et al.: Eur. J. Pharmacol., 294, 75 (1995), Roman, F., et al.: J. Pharmacol. Exp. Ther., 289, 1391 (1999), Kayser, V., et al.: Life Sci., 66, 433(2000),Formula:C20H25NO5Color and Shape:NeatMolecular weight:359.42
