CAS 84348-86-7

1,2,3,5-tetrafluoro-4-isothiocyanatobenzene

Description:

1,2,3,5-Tetrafluoro-4-isothiocyanatobenzene is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with four fluorine atoms and an isothiocyanate group. The presence of fluorine atoms enhances the compound's stability and lipophilicity, making it useful in various chemical applications. The isothiocyanate functional group (-N=C=S) is known for its reactivity, particularly in nucleophilic addition reactions, and can serve as a versatile building block in organic synthesis. This compound is typically a solid at room temperature and may exhibit low solubility in water, while being more soluble in organic solvents. Its properties make it of interest in fields such as materials science, agrochemicals, and pharmaceuticals. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactivity and potential toxicity. Overall, 1,2,3,5-tetrafluoro-4-isothiocyanatobenzene is a significant compound in synthetic chemistry with potential applications in various industries.

Formula: C₇HF₄NS

InChI: InChI=1/C7HF4NS/c8-3-1-4(9)7(12-2-13)6(11)5(3)10/h1H

SMILES: c1c(c(c(c(c1F)N=C=S)F)F)F

Synonyms:

• 2,3,4,6-Tetrafluorophenyl Isothiocyanate
• Benzene, 1,2,3,5-Tetrafluoro-4-Isothiocyanato-
• 1,2,3,5-Tetrafluoro-4-isothiocyanatobenzene