CymitQuimica logo

CAS 84359-15-9

:

1-(pyridin-3-yl)methanamine dihydrochloride

Description:
1-(Pyridin-3-yl)methanamine dihydrochloride, with the CAS number 84359-15-9, is a chemical compound characterized by its structure, which includes a pyridine ring substituted with a methanamine group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility. The presence of the pyridine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. It may exhibit properties such as being a ligand for various receptors or enzymes, and its amine group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. As with many amines, it may also be basic, allowing it to form salts with acids. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety protocols are followed.
Formula:C6H10Cl2N2
InChI:InChI=1/C6H8N2.2ClH/c7-4-6-2-1-3-8-5-6;;/h1-3,5H,4,7H2;2*1H
SMILES:c1cc(CN)cnc1.Cl.Cl
Synonyms:
  • 3-Aminomethylpyridine Dihydrochloride
  • 3-Pyridinemethanamine, Hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.