CAS 84360-53-2

(2-Methylphenyl)(tetrahydro-2,2-dimethyl-2H-pyran-4-yl)methanone

Description:

The chemical substance known as (2-Methylphenyl)(tetrahydro-2,2-dimethyl-2H-pyran-4-yl)methanone, with the CAS number 84360-53-2, is an organic compound characterized by its complex structure, which includes a ketone functional group and a tetrahydropyran moiety. This compound features a 2-methylphenyl group, contributing to its aromatic characteristics, and a tetrahydro-2,2-dimethyl-2H-pyran-4-yl group, which adds to its cyclic and saturated nature. The presence of the ketone functional group suggests potential reactivity in various chemical reactions, such as nucleophilic additions or reductions. The compound's molecular structure indicates it may exhibit moderate polarity, influencing its solubility in organic solvents. Additionally, due to its unique arrangement of functional groups, it may possess interesting biological activities, making it a candidate for further research in medicinal chemistry. Overall, this compound exemplifies the diversity of organic chemistry and the potential for complex interactions in biological systems.

Formula: C₁₅H₂₀O₂

InChI: InChI=1S/C15H20O2/c1-11-6-4-5-7-13(11)14(16)12-8-9-17-15(2,3)10-12/h4-7,12H,8-10H2,1-3H3

InChI key: InChIKey=QNQDVPBBONNAKE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC=C1)C2CC(C)(C)OCC2

Synonyms:

• Methanone, (2-methylphenyl)(tetrahydro-2,2-dimethyl-2H-pyran-4-yl)-
• (2,2-Dimethyloxan-4-yl)-(2-methylphenyl)methanone
• (2-Methylphenyl)(tetrahydro-2,2-dimethyl-2H-pyran-4-yl)methanone