CymitQuimica logo

CAS 843608-47-9

:

2-(Methylthio)-α-(trifluoromethyl)benzenemethanamine

Description:
2-(Methylthio)-α-(trifluoromethyl)benzenemethanamine, identified by its CAS number 843608-47-9, is an organic compound characterized by the presence of a trifluoromethyl group and a methylthio group attached to a benzene ring. This compound features a primary amine functional group, which contributes to its reactivity and potential applications in various chemical reactions. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing the compound's overall stability and reactivity. The methylthio group can enhance the compound's solubility in organic solvents and may also play a role in biological activity. The presence of these functional groups suggests potential applications in pharmaceuticals, agrochemicals, or materials science. Additionally, the compound's structural characteristics may allow for interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H10F3NS
InChI:InChI=1S/C9H10F3NS/c1-14-7-5-3-2-4-6(7)8(13)9(10,11)12/h2-5,8H,13H2,1H3
InChI key:InChIKey=OWLNHHNBXPNCRL-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=C(SC)C=CC=C1
Synonyms:
  • 2-(Methylthio)-α-(trifluoromethyl)benzenemethanamine
  • Benzenemethanamine, 2-(methylthio)-α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.