CymitQuimica logo

CAS 843608-50-4

:

α-(Trifluoromethyl)-2-naphthalenemethanamine

Description:
α-(Trifluoromethyl)-2-naphthalenemethanamine, with the CAS number 843608-50-4, is an organic compound characterized by the presence of a trifluoromethyl group attached to a naphthalene ring system. This compound features a naphthalene backbone, which consists of two fused benzene rings, providing it with significant aromatic stability and hydrophobic characteristics. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can influence the compound's reactivity and polarity. As an amine, it contains a primary amine functional group, which can participate in hydrogen bonding and nucleophilic reactions. The presence of both the naphthalene structure and the trifluoromethyl group may impart unique physical and chemical properties, such as increased lipophilicity and potential biological activity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex chemical entities.
Formula:C12H10F3N
InChI:InChI=1S/C12H10F3N/c13-12(14,15)11(16)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H,16H2
InChI key:InChIKey=OWHGHTQGZFFGAL-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=CC2=C(C=C1)C=CC=C2
Synonyms:
  • α-(Trifluoromethyl)-2-naphthalenemethanamine
  • 2,2,2-Trifluoro-1-(naphthalen-2-yl)ethan-1-amine
  • 2-Naphthalenemethanamine, α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.