CAS 843663-18-3
:4-Cyano-3-fluorobenzeneboronic acid
Description:
4-Cyano-3-fluorobenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, a cyano group, and a fluorine atom attached to a benzene ring. This compound typically exhibits a white to off-white crystalline appearance. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and materials science. The cyano group contributes to the compound's polarity and potential reactivity, while the fluorine atom can influence the electronic properties and stability of the molecule. Additionally, 4-Cyano-3-fluorobenzeneboronic acid may exhibit solubility in polar organic solvents, which is advantageous for its application in various chemical processes. Its unique combination of functional groups makes it a useful intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. As with many boronic acids, care should be taken in handling due to potential reactivity and the need for specific storage conditions to maintain stability.
Formula:C7H5BFNO2
InChI:InChI=1/C7H5BFNO2/c9-7-3-6(8(11)12)2-1-5(7)4-10/h1-3,11-12H
SMILES:c1cc(cc(c1C#N)F)B(O)O
Synonyms:- (4-Cyano-3-fluorophenyl)boronic acid
- Boronic acid, (4-cyano-3-fluorophenyl)-
- Boronic acid, B-(4-cyano-3-fluorophenyl)-
- 4-Cyano-3-fluorophenylboronic acid
- 4-Borono-2-fluorobenzonitrile
- 4-Cyano3-fluorophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Cyano-3-fluorobenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H5BFNO2Purity:97%Color and Shape:Yellow, powderMolecular weight:164.934-Cyano-3-fluorophenylboronic acid
CAS:Formula:C7H5BFNO2Purity:95%Color and Shape:SolidMolecular weight:164.92954-Cyano-3-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H5BFNO2Purity:97.0 to 112.5 %Color and Shape:White to Almost white powder to crystalMolecular weight:164.934-Cyano-3-fluorobenzeneboronic acid
CAS:4-Cyano-3-fluorobenzeneboronic acidFormula:C7H5BFNO2Purity:97%Color and Shape: faint yellow powderMolecular weight:164.93g/mol4-Cyano-3-fluorophenylboronic acid
CAS:Formula:C7H5BFNO2Purity:95%Color and Shape:SolidMolecular weight:164.93




