CAS 84376-20-5
:3,5-difluoro-2-hydroxybenzoic acid
Description:
3,5-Difluoro-2-hydroxybenzoic acid is an aromatic compound characterized by the presence of two fluorine atoms and a hydroxyl group attached to a benzoic acid structure. The molecular formula is C7H5F2O3, indicating that it contains seven carbon atoms, five hydrogen atoms, two fluorine atoms, and three oxygen atoms. This compound typically exhibits acidic properties due to the carboxylic acid functional group, allowing it to donate protons in solution. The presence of fluorine atoms enhances its reactivity and can influence its solubility and biological activity. The hydroxyl group contributes to its potential as a hydrogen bond donor, which can affect its interactions with other molecules. 3,5-Difluoro-2-hydroxybenzoic acid may be used in various applications, including pharmaceuticals and agrochemicals, due to its unique chemical properties. Its structural characteristics also suggest potential for use in research related to drug design and development, particularly in the context of compounds that require specific electronic and steric properties.
Formula:C7H4F2O3
InChI:InChI=1/C7H4F2O3/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,10H,(H,11,12)
SMILES:c1c(cc(c(c1C(=O)O)O)F)F
Synonyms:- 3,5-Difluoro-2-Hydroxy-Benzoic Acid
- 3,5-Difluorosalicylic acid
- 84376-20-5 [Rn]
- Benzoic acid, 3,5-difluoro-2-hydroxy-
- Qvr Bq Cf Ef [Wln]
- 3,5-Difluoro-2-hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Difluorosalicylic acid, 98+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H4F2O3Purity:98+%Color and Shape:White to cream, PowderMolecular weight:174.103,5-Difluoro-2-hydroxybenzoic acid
CAS:<p>3,5-Difluoro-2-hydroxybenzoic acid</p>Formula:C7H4F2O3Purity:≥95%Color and Shape: white to off-white solidMolecular weight:174.10g/mol3,5-Difluoro-2-hydroxybenzoic acid
CAS:Formula:C7H4F2O3Purity:98%Color and Shape:White powderMolecular weight:174.103



