
CAS 84379-52-2
:(2R,3R)-3-(Phenylmethoxy)-1,2,4-butanetriol
Description:
(2R,3R)-3-(Phenylmethoxy)-1,2,4-butanetriol, with the CAS number 84379-52-2, is a chiral organic compound characterized by its specific stereochemistry, indicated by the (2R,3R) configuration. This compound features a butanetriol backbone, which includes three hydroxyl (-OH) groups, contributing to its hydrophilicity and potential for forming hydrogen bonds. The presence of a phenylmethoxy group enhances its lipophilicity, allowing for interactions with non-polar environments. This dual nature of the molecule may influence its solubility in various solvents, making it potentially useful in pharmaceutical applications or as a chemical intermediate. The stereochemistry is crucial for its biological activity, as enantiomers can exhibit different properties and reactivities. Additionally, the compound may participate in various chemical reactions, including esterification and etherification, due to the reactive hydroxyl groups. Overall, (2R,3R)-3-(Phenylmethoxy)-1,2,4-butanetriol is a versatile compound with applications in organic synthesis and medicinal chemistry, particularly in the development of chiral drugs.
Formula:C11H16O4
InChI:InChI=1S/C11H16O4/c12-6-10(14)11(7-13)15-8-9-4-2-1-3-5-9/h1-5,10-14H,6-8H2/t10-,11-/m1/s1
InChI key:InChIKey=YYGZBCNOJHZTGA-GHMZBOCLSA-N
SMILES:C(O[C@@H]([C@@H](CO)O)CO)C1=CC=CC=C1
Synonyms:- 1,2,4-Butanetriol, 3-(phenylmethoxy)-, [R-(R*,R*)]-
- 1,2,4-Butanetriol, 3-(phenylmethoxy)-, (2R,3R)-
- (2R,3R)-3-(Phenylmethoxy)-1,2,4-butanetriol
- (2R,3R)-3-(Benzyloxy)butane-1,2,4-triol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
