CAS 84392-23-4

4'-(Trifluoromethyl)-2-biphenylcarboxaldehyde

Description:

4'-(Trifluoromethyl)-2-biphenylcarboxaldehyde, with the CAS number 84392-23-4, is an organic compound characterized by the presence of a trifluoromethyl group and a biphenyl structure. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The trifluoromethyl group contributes to its unique electronic properties, enhancing its lipophilicity and potentially influencing its biological activity. The biphenyl moiety provides a stable aromatic framework, which can facilitate various chemical reactions, including electrophilic substitutions. This compound is typically used in research and development, particularly in the synthesis of pharmaceuticals and agrochemicals, due to its ability to serve as a versatile building block. Additionally, its physical properties, such as melting point and solubility, can vary based on the specific conditions and solvents used. Overall, 4'-(Trifluoromethyl)-2-biphenylcarboxaldehyde is a valuable compound in the field of organic chemistry, with implications for both industrial and academic research.

Formula: C₁₄H₉F₃O

InChI: InChI=1/C14H9F3O/c15-14(16,17)12-7-5-10(6-8-12)13-4-2-1-3-11(13)9-18/h1-9H

SMILES: c1ccc(c2ccc(cc2)C(F)(F)F)c(c1)C=O

Synonyms:

• 4'-(Trifluoromethyl)Biphenyl-2-Carbaldehyde

2-[4-(TRIFLUOROMETHYL)PHENYL]BENZALDEHYDE

CAS: 84392-23-4

Formula: C₁₄H₉F₃O

Purity: 98%

Molecular weight: 250.2159

Ref: IN-DA00G2QI

4'-(Trifluoromethyl)[1,1'-biphenyl]-2-carboxaldehyde

CAS: 84392-23-4

4'-(Trifluoromethyl)[1,1'-biphenyl]-2-carboxaldehyde

Purity: 98%

Molecular weight: 250.22g/mol

Ref: 54-PC11171

4′-Trifluoromethylbiphenyl-2-carbaldehyde

CAS: 84392-23-4

Formula: C₁₄H₉F₃O

Purity: 98%

Molecular weight: 250.22

Ref: 10-F014316