CAS 84392-26-7
:4′-(1,1-Dimethylethyl)[1,1′-biphenyl]-2-carboxylic acid
Description:
4′-(1,1-Dimethylethyl)[1,1′-biphenyl]-2-carboxylic acid, identified by its CAS number 84392-26-7, is an organic compound characterized by its biphenyl structure substituted with a tert-butyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points compared to aliphatic compounds. The presence of the carboxylic acid group contributes to its acidity and potential for hydrogen bonding, influencing its solubility in polar solvents. The tert-butyl group enhances the steric bulk around the biphenyl core, which can affect its reactivity and interactions with other molecules. This compound may be utilized in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals and agrochemicals. Its specific characteristics, such as solubility, reactivity, and stability, can vary based on environmental conditions and the presence of other functional groups in a given reaction context.
Formula:C17H18O2
InChI:InChI=1S/C17H18O2/c1-17(2,3)13-10-8-12(9-11-13)14-6-4-5-7-15(14)16(18)19/h4-11H,1-3H3,(H,18,19)
InChI key:InChIKey=WYIJUURMGVBXEM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C2=CC=C(C(C)(C)C)C=C2
Synonyms:- 2-(4-tert-Butylphenyl)benzoic acid
- 4'-Tert-Butyl-1,1'-Biphenyl-2-Carboxylic Acid
- 4′-(1,1-Dimethylethyl)[1,1′-biphenyl]-2-carboxylic acid
- [1,1'-Biphenyl]-2-carboxylic acid, 4'-(1,1-dimethylethyl)-
- 4′-tert-Butylbiphenyl-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4′-(1,1-Dimethylethyl)[1,1′-biphenyl]-2-carboxylic acid
CAS:Formula:C17H18O2Color and Shape:SolidMolecular weight:254.3236
