CAS 84400-98-6

furo[2,3-c]pyridin-7(6H)-one

Description:

Furo[2,3-c]pyridin-7(6H)-one, identified by its CAS number 84400-98-6, is a heterocyclic organic compound featuring a fused ring system that includes both a furan and a pyridine moiety. This compound typically exhibits a bicyclic structure, characterized by the presence of a nitrogen atom in the pyridine ring and an oxygen atom in the furan ring. It is known for its potential biological activities, which may include antimicrobial and anti-inflammatory properties, making it of interest in medicinal chemistry. The compound is generally soluble in organic solvents and may exhibit moderate stability under standard conditions. Its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. Additionally, furo[2,3-c]pyridin-7(6H)-one can serve as a valuable building block in the synthesis of more complex molecules, contributing to the development of pharmaceuticals and agrochemicals. As with many heterocycles, its properties can vary significantly based on substitution patterns and the presence of other functional groups.

Formula: C₇H₅NO₂

InChI: InChI=1/C7H5NO2/c9-7-6-5(1-3-8-7)2-4-10-6/h1-4H,(H,8,9)

SMILES: c1cnc(c2c1cco2)O

Synonyms:

• Furo[2,3-c]pyridin-7(6H)-one

Furo[2,3-c]pyridin-7(6H)-one

CAS: 84400-98-6

Formula: C₇H₅NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 135.1201

Ref: IN-DA0055R8

Furo[2,3-C]Pyridin-7(6H)-One

CAS: 84400-98-6

Furo[2,3-C]Pyridin-7(6H)-One

Purity: 97%

Molecular weight: 135.12g/mol

Ref: 54-OR1013411

FURO[2,3-C]PYRIDINE-7(6H)-ONE

CAS: 84400-98-6

Formula: C₇H₅NO₂

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 135.122

Ref: 10-F501770

Furo[2,3-c]pyridine-7(6H)-one

CAS: 84400-98-6

Furo[2,3-c]pyridine-7(6H)-one (FP) is a photocycloaddition compound that has been shown to react with chlorine to form oxychloride. It is also able to react with azide and malonic acid in the presence of an oxidizing agent, such as phosphorus oxychloride. FP has been shown to have a high affinity for magnetic resonance imaging (MRI), which may be due to its ability to undergo resonance spectroscopy at higher frequencies than other compounds. FP can be synthesized by the reaction of 2,5-dichlorobenzene and diphenylmethane in the presence of carbonyl and acrylic acid. The crystal x-ray diffraction pattern of FP shows it is hexagonal with a space group P6 3 /mmc. FP can be synthesized by the reaction of 2,5-dichlorobenzene and diphenylmethane

Formula: C₇H₅NO₂

Purity: Min. 95%

Molecular weight: 135.12 g/mol

Ref: 3D-JDA40098