CAS 84400-99-7

7-chlorofuro[2,3-c]pyridine

Description:

7-Chlorofuro[2,3-c]pyridine is a heterocyclic compound characterized by its fused ring structure, which includes both a furan and a pyridine moiety. The presence of a chlorine atom at the 7-position of the pyridine ring contributes to its unique chemical properties, influencing its reactivity and potential applications. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and material science. The compound may exhibit biological activity, potentially serving as a scaffold for the development of pharmaceuticals. Additionally, its chlorinated nature may enhance its stability and lipophilicity, which are important factors in drug design. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks. Overall, 7-chlorofuro[2,3-c]pyridine is a significant compound in the realm of organic chemistry, with potential implications in various fields.

Formula: C₇H₄ClNO

InChI: InChI=1/C7H4ClNO/c8-7-6-5(1-3-9-7)2-4-10-6/h1-4H

SMILES: c1cnc(c2c1cco2)Cl

Synonyms:

• Furo[2,3-c]pyridine, 7-chloro-

7-Chlorofuro[2,3-c]pyridine

CAS: 84400-99-7

Formula: C₇H₄ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.5658

Ref: IN-DA0055R7

7-Chlorofuro[2,3-c]pyridine

CAS: 84400-99-7

7-Chlorofuro[2,3-c]pyridine

Formula: C₇H₄ClNO

Purity: ≥95%

Color and Shape: light brown solid

Molecular weight: 153.57g/mol

Ref: 54-OR55233

7-Chlorofuro[2,3-c]pyridine

CAS: 84400-99-7

Formula: C₇H₄ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.57

Ref: 10-F465079

7-Chlorofuro[2,3-c]pyridine

Controlled Product

CAS: 84400-99-7

Formula: C₇H₄ClNO

Color and Shape: Neat

Molecular weight: 153.566

Ref: TR-C368443