CAS 84403-78-1

4-[(2-Chlorophenyl)methoxy]benzoic acid

Description:

4-[(2-Chlorophenyl)methoxy]benzoic acid, with the CAS number 84403-78-1, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a methoxy group attached to a chlorophenyl substituent. This compound typically exhibits properties associated with aromatic acids, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic rings. The presence of the chlorine atom on the phenyl ring can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical species. The methoxy group serves as an electron-donating substituent, which can affect the acidity of the carboxylic acid group. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in drug development or as a biochemical tool. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography.

Formula: C₁₄H₁₁ClO₃

InChI: InChI=1S/C14H11ClO3/c15-13-4-2-1-3-11(13)9-18-12-7-5-10(6-8-12)14(16)17/h1-8H,9H2,(H,16,17)

InChI key: InChIKey=LPILWQCXDRPDBT-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=CC=C1)C2=CC=C(C(O)=O)C=C2

Synonyms:

• 4-[(2-Chlorophenyl)methoxy]benzoic acid
• Benzoic acid, 4-[(2-chlorophenyl)methoxy]-

4-[(2-Chlorobenzyl)oxy]benzoic acid

CAS: 84403-78-1

4-[(2-Chlorobenzyl)oxy]benzoic acid is a chemical building block that has been used in the synthesis of organic compounds. It is an intermediate for the production of many different products, such as pharmaceuticals and pesticides. 4-[(2-Chlorobenzyl)oxy]benzoic acid is a versatile building block that can be used to synthesize a wide range of complex compounds. This compound is also useful as a reagent in research.

Formula: C₁₄H₁₁ClO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 262.69 g/mol

Ref: 3D-FC119032