CAS 84407-13-6

2-(4-aminopyrazol-1-yl)ethanol

Description:

2-(4-Aminopyrazol-1-yl)ethanol, with the CAS number 84407-13-6, is an organic compound characterized by its pyrazole ring structure substituted with an amino group and an ethanol moiety. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in water due to the presence of the hydroxyl group in the ethanol part of its structure. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents. It may also exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with potential therapeutic applications. The presence of both the pyrazole and amino functionalities suggests that it could interact with various biological targets, potentially influencing enzymatic or receptor-mediated processes. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-(4-aminopyrazol-1-yl)ethanol is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₅H₉N₃O

InChI: InChI=1/C5H9N3O/c6-5-3-7-8(4-5)1-2-9/h3-4,9H,1-2,6H2

SMILES: C(CO)n1cc(cn1)N

2-(4-Amino-1H-pyrazol-1-yl)ethanol

CAS: 84407-13-6

Formula: C₅H₉N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 127.1445

Ref: IN-DA008I86

2-(3-Amino-1H-pyrazol-1-yl)ethanol

CAS: 84407-13-6

2-(3-Amino-1H-pyrazol-1-yl)ethanol

Purity: 98%

Molecular weight: 127.15g/mol

Ref: 54-OR75319

2-(3-Amino-1H-pyrazol-1-yl)ethanol

CAS: 84407-13-6

Formula: C₅H₉N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 127.147

Ref: 10-F227694